C29H34N2O5S2 — CID 19252187
2-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid (PubChem CID 19252187) has the molecular formula C29H34N2O5S2 and a molecular weight of 554.73 g/mol. Its IUPAC name is 2-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid.
| Compound Name | 2-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 19252187 |
| Molecular Formula | C29H34N2O5S2 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(C(C)(C)C)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C29H34N2O5S2/c1-12(2)10-17(27(34)35)31-25(32)20-15-11-16(21(20)26(31)33)22-19(15)18(23-24(37-22)30-28(36)38-23)13-6-8-14(9-7-13)29(3,4)5/h6-9,12,15-22H,10-11H2,1-5H3,(H,30,36)(H,34,35) |
| InChIKey | SHNWIGCQRDFYOL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|