C26H28N2O4S3 — CID 18865562
2-[9-(4-tert-butylphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 18865562) has the molecular formula C26H28N2O4S3 and a molecular weight of 528.72 g/mol. Its IUPAC name is 2-[9-(4-tert-butylphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 2-[9-(4-tert-butylphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 18865562 |
| Molecular Formula | C26H28N2O4S3 |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 2-[9-(4-tert-butylphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(C(C)(C)C)cc2)c2sc(=S)[nH]c2SC31 |
| InChI | InChI=1S/C26H28N2O4S3/c1-10(24(31)32)28-22(29)17-13-9-14(18(17)23(28)30)19-16(13)15(20-21(34-19)27-25(33)35-20)11-5-7-12(8-6-11)26(2,3)4/h5-8,10,13-19H,9H2,1-4H3,(H,27,33)(H,31,32) |
| InChIKey | UKSUWBXJMPGBER-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|