C23H23NO3S3 — CID 18865729
9-(4-tert-butylphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione (PubChem CID 18865729) has the molecular formula C23H23NO3S3 and a molecular weight of 457.64 g/mol. Its IUPAC name is 9-(4-tert-butylphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione.
| Compound Name | 9-(4-tert-butylphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
|---|---|
| PubChem CID | 18865729 |
| Molecular Formula | C23H23NO3S3 |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 9-(4-tert-butylphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
| SMILES | CC(C)(C)c1ccc(C2c3sc(=S)[nH]c3SC3C4CC(C5C(=O)OC(=O)C45)C23)cc1 |
| InChI | InChI=1S/C23H23NO3S3/c1-23(2,3)10-6-4-9(5-7-10)13-14-11-8-12(16-15(11)20(25)27-21(16)26)17(14)29-19-18(13)30-22(28)24-19/h4-7,11-17H,8H2,1-3H3,(H,24,28) |
| InChIKey | NEELJKMUQOINLO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|