C26H28N2O5S2 — CID 18861720
methyl 2-[9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate (PubChem CID 18861720) has the molecular formula C26H28N2O5S2 and a molecular weight of 512.65 g/mol. Its IUPAC name is methyl 2-[9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate.
| Compound Name | methyl 2-[9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
|---|---|
| PubChem CID | 18861720 |
| Molecular Formula | C26H28N2O5S2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | methyl 2-[9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(C(C)(C)C)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C26H28N2O5S2/c1-26(2,3)12-7-5-11(6-8-12)16-17-13-9-14(20(17)34-22-21(16)35-25(32)27-22)19-18(13)23(30)28(24(19)31)10-15(29)33-4/h5-8,13-14,16-20H,9-10H2,1-4H3,(H,27,32) |
| InChIKey | IIBUCGMJZITMNH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|