C22H20N2O6S2 — CID 18861716
methyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate (PubChem CID 18861716) has the molecular formula C22H20N2O6S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is methyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate.
| Compound Name | methyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
|---|---|
| PubChem CID | 18861716 |
| Molecular Formula | C22H20N2O6S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | methyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(O)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C22H20N2O6S2/c1-30-12(26)7-24-20(27)15-10-6-11(16(15)21(24)28)17-14(10)13(8-2-4-9(25)5-3-8)18-19(31-17)23-22(29)32-18/h2-5,10-11,13-17,25H,6-7H2,1H3,(H,23,29) |
| InChIKey | OXEMTJCHVPOJMI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|