C22H20N2O6S2 — CID 98150297
3-[(1R,2S,9S,10R,11R,12R,16S)-9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 98150297) has the molecular formula C22H20N2O6S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is 3-[(1R,2S,9S,10R,11R,12R,16S)-9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 3-[(1R,2S,9S,10R,11R,12R,16S)-9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 98150297 |
| Molecular Formula | C22H20N2O6S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 3-[(1R,2S,9S,10R,11R,12R,16S)-9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]4Sc5[nH]c(=O)sc5[C@H](c5ccc(O)cc5)[C@@H]34)[C@H]2C1=O |
| InChI | InChI=1S/C22H20N2O6S2/c25-9-3-1-8(2-4-9)13-14-10-7-11(17(14)31-19-18(13)32-22(30)23-19)16-15(10)20(28)24(21(16)29)6-5-12(26)27/h1-4,10-11,13-17,25H,5-7H2,(H,23,30)(H,26,27)/t10-,11+,13+,14+,15+,16+,17-/m0/s1 |
| InChIKey | SIKJFPYAWOXDLM-PBEUZJTRSA-N |
| XLogP | 2.09 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|