C29H26N2O6S2 — CID 19251977
3-[(9S)-6,13,15-trioxo-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 19251977) has the molecular formula C29H26N2O6S2 and a molecular weight of 562.67 g/mol. Its IUPAC name is 3-[(9S)-6,13,15-trioxo-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 3-[(9S)-6,13,15-trioxo-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 19251977 |
| Molecular Formula | C29H26N2O6S2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 3-[(9S)-6,13,15-trioxo-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(OCc4ccccc4)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C29H26N2O6S2/c32-19(33)10-11-31-27(34)22-17-12-18(23(22)28(31)35)24-21(17)20(25-26(38-24)30-29(36)39-25)15-6-8-16(9-7-15)37-13-14-4-2-1-3-5-14/h1-9,17-18,20-24H,10-13H2,(H,30,36)(H,32,33) |
| InChIKey | LVZAROATEQEAOA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|