C31H30N2O6S2 — CID 19252037
4-[(9S)-9-[4-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 19252037) has the molecular formula C31H30N2O6S2 and a molecular weight of 590.72 g/mol. Its IUPAC name is 4-[(9S)-9-[4-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 4-[(9S)-9-[4-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 19252037 |
| Molecular Formula | C31H30N2O6S2 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 4-[(9S)-9-[4-[(4-methylphenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | Cc1ccc(COc2ccc(C3c4sc(=O)[nH]c4SC4C5CC(C6C(=O)N(CCCC(=O)O)C(=O)C56)C34)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O6S2/c1-15-4-6-16(7-5-15)14-39-18-10-8-17(9-11-18)22-23-19-13-20(26(23)40-28-27(22)41-31(38)32-28)25-24(19)29(36)33(30(25)37)12-2-3-21(34)35/h4-11,19-20,22-26H,2-3,12-14H2,1H3,(H,32,38)(H,34,35) |
| InChIKey | NKTMJNKNSRHRQY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|