C29H25ClN2O6S2 — CID 19251979
3-[(9S)-9-[4-[(4-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 19251979) has the molecular formula C29H25ClN2O6S2 and a molecular weight of 597.11 g/mol. Its IUPAC name is 3-[(9S)-9-[4-[(4-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 3-[(9S)-9-[4-[(4-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 19251979 |
| Molecular Formula | C29H25ClN2O6S2 |
| Molecular Weight | 597.11 g/mol |
| Exact Mass | 596.08 |
| IUPAC Name | 3-[(9S)-9-[4-[(4-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(OCc4ccc(Cl)cc4)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C29H25ClN2O6S2/c30-15-5-1-13(2-6-15)12-38-16-7-3-14(4-8-16)20-21-17-11-18(24(21)39-26-25(20)40-29(37)31-26)23-22(17)27(35)32(28(23)36)10-9-19(33)34/h1-8,17-18,20-24H,9-12H2,(H,31,37)(H,33,34) |
| InChIKey | QPEFSDNACNNXKP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.11 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|