C33H27ClN2O4S2 — CID 19250609
(1R,2R,9R,10S,11S,12S,16R)-14-(4-chlorophenyl)-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 19250609) has the molecular formula C33H27ClN2O4S2 and a molecular weight of 615.18 g/mol. Its IUPAC name is (1R,2R,9R,10S,11S,12S,16R)-14-(4-chlorophenyl)-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2R,9R,10S,11S,12S,16R)-14-(4-chlorophenyl)-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 19250609 |
| Molecular Formula | C33H27ClN2O4S2 |
| Molecular Weight | 615.18 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | (1R,2R,9R,10S,11S,12S,16R)-14-(4-chlorophenyl)-9-[4-[(4-methylphenyl)methoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | Cc1ccc(COc2ccc([C@@H]3c4sc(=O)[nH]c4S[C@@H]4[C@@H]5C[C@@H]([C@@H]6C(=O)N(c7ccc(Cl)cc7)C(=O)[C@@H]56)[C@@H]34)cc2)cc1 |
| InChI | InChI=1S/C33H27ClN2O4S2/c1-16-2-4-17(5-3-16)15-40-21-12-6-18(7-13-21)24-25-22-14-23(28(25)41-30-29(24)42-33(39)35-30)27-26(22)31(37)36(32(27)38)20-10-8-19(34)9-11-20/h2-13,22-28H,14-15H2,1H3,(H,35,39)/t22-,23-,24+,25+,26+,27+,28-/m1/s1 |
| InChIKey | BFLQZNUSFOVFIL-FJTPXLNLSA-N |
| XLogP | 6.66 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.18 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|