C28H24N2O6S2 — CID 98176401
3-[(1R,2R,9S,10R,11R,12R,16S)-6,13,15-trioxo-9-(3-phenoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 98176401) has the molecular formula C28H24N2O6S2 and a molecular weight of 548.64 g/mol. Its IUPAC name is 3-[(1R,2R,9S,10R,11R,12R,16S)-6,13,15-trioxo-9-(3-phenoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 3-[(1R,2R,9S,10R,11R,12R,16S)-6,13,15-trioxo-9-(3-phenoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 98176401 |
| Molecular Formula | C28H24N2O6S2 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 3-[(1R,2R,9S,10R,11R,12R,16S)-6,13,15-trioxo-9-(3-phenoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H]4Sc5[nH]c(=O)sc5[C@H](c5cccc(Oc6ccccc6)c5)[C@@H]34)[C@H]2C1=O |
| InChI | InChI=1S/C28H24N2O6S2/c31-18(32)9-10-30-26(33)21-16-12-17(22(21)27(30)34)23-20(16)19(24-25(37-23)29-28(35)38-24)13-5-4-8-15(11-13)36-14-6-2-1-3-7-14/h1-8,11,16-17,19-23H,9-10,12H2,(H,29,35)(H,31,32)/t16-,17+,19+,20+,21+,22+,23+/m0/s1 |
| InChIKey | QLPYEHARTDMHBH-NEWZCOGQSA-N |
| XLogP | 4.18 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|