C25H26N2O6S2 — CID 18861704
butyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate (PubChem CID 18861704) has the molecular formula C25H26N2O6S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is butyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate.
| Compound Name | butyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
|---|---|
| PubChem CID | 18861704 |
| Molecular Formula | C25H26N2O6S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | butyl 2-[9-(4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(O)cc2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C25H26N2O6S2/c1-2-3-8-33-15(29)10-27-23(30)18-13-9-14(19(18)24(27)31)20-17(13)16(11-4-6-12(28)7-5-11)21-22(34-20)26-25(32)35-21/h4-7,13-14,16-20,28H,2-3,8-10H2,1H3,(H,26,32) |
| InChIKey | WCZRHFBEAJRCAV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|