C25H26N2O7S2 — CID 124769864
ethyl 2-[(1R,2S,9S,10R,11S,12S,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate (PubChem CID 124769864) has the molecular formula C25H26N2O7S2 and a molecular weight of 530.62 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,9S,10R,11S,12S,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,9S,10R,11S,12S,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
|---|---|
| PubChem CID | 124769864 |
| Molecular Formula | C25H26N2O7S2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | ethyl 2-[(1R,2S,9S,10R,11S,12S,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@@H](c2ccc(OC)c(OC)c2)c2sc(=O)[nH]c2S[C@@H]31 |
| InChI | InChI=1S/C25H26N2O7S2/c1-4-34-15(28)9-27-23(29)18-11-8-12(19(18)24(27)30)20-17(11)16(21-22(35-20)26-25(31)36-21)10-5-6-13(32-2)14(7-10)33-3/h5-7,11-12,16-20H,4,8-9H2,1-3H3,(H,26,31)/t11-,12-,16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | ILIWIHNLKASJOV-UOIBIHNKSA-N |
| XLogP | 2.49 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|