C25H26N2O7S2 — CID 98151817
4-[(1R,2R,9S,10R,11R,12R,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 98151817) has the molecular formula C25H26N2O7S2 and a molecular weight of 530.62 g/mol. Its IUPAC name is 4-[(1R,2R,9S,10R,11R,12R,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 4-[(1R,2R,9S,10R,11R,12R,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 98151817 |
| Molecular Formula | C25H26N2O7S2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 4-[(1R,2R,9S,10R,11R,12R,16S)-9-(3,4-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | COc1ccc([C@H]2c3sc(=O)[nH]c3S[C@@H]3[C@@H]4C[C@H]([C@H]5C(=O)N(CCCC(=O)O)C(=O)[C@H]45)[C@H]23)cc1OC |
| InChI | InChI=1S/C25H26N2O7S2/c1-33-13-6-5-10(8-14(13)34-2)16-17-11-9-12(20(17)35-22-21(16)36-25(32)26-22)19-18(11)23(30)27(24(19)31)7-3-4-15(28)29/h5-6,8,11-12,16-20H,3-4,7,9H2,1-2H3,(H,26,32)(H,28,29)/t11-,12+,16+,17+,18+,19+,20+/m0/s1 |
| InChIKey | OYHUVFMUVOPDKA-YZTHKVPGSA-N |
| XLogP | 2.79 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|