C32H30FN3O8S2 — CID 19255609
4-[(9S)-9-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 19255609) has the molecular formula C32H30FN3O8S2 and a molecular weight of 667.74 g/mol. Its IUPAC name is 4-[(9S)-9-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 4-[(9S)-9-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 19255609 |
| Molecular Formula | C32H30FN3O8S2 |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.15 |
| IUPAC Name | 4-[(9S)-9-[4-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CCCC(=O)O)C(=O)C45)C23)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C32H30FN3O8S2/c1-43-20-11-14(4-9-19(20)44-13-21(37)34-16-7-5-15(33)6-8-16)23-24-17-12-18(27(24)45-29-28(23)46-32(42)35-29)26-25(17)30(40)36(31(26)41)10-2-3-22(38)39/h4-9,11,17-18,23-27H,2-3,10,12-13H2,1H3,(H,34,37)(H,35,42)(H,38,39) |
| InChIKey | XYLBJOAMPSQLNI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|