C34H35N3O8S2 — CID 19255732
6-[(9S)-9-[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 19255732) has the molecular formula C34H35N3O8S2 and a molecular weight of 677.80 g/mol. Its IUPAC name is 6-[(9S)-9-[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(9S)-9-[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 19255732 |
| Molecular Formula | C34H35N3O8S2 |
| Molecular Weight | 677.80 g/mol |
| Exact Mass | 677.19 |
| IUPAC Name | 6-[(9S)-9-[4-(2-anilino-2-oxoethoxy)-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CCCCCC(=O)O)C(=O)C45)C23)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C34H35N3O8S2/c1-44-22-14-17(11-12-21(22)45-16-23(38)35-18-8-4-2-5-9-18)25-26-19-15-20(29(26)46-31-30(25)47-34(43)36-31)28-27(19)32(41)37(33(28)42)13-7-3-6-10-24(39)40/h2,4-5,8-9,11-12,14,19-20,25-29H,3,6-7,10,13,15-16H2,1H3,(H,35,38)(H,36,43)(H,39,40) |
| InChIKey | XGNAYFQMGZPUPW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|