C30H36N2O7S2 — CID 16558063
6-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 16558063) has the molecular formula C30H36N2O7S2 and a molecular weight of 600.76 g/mol. Its IUPAC name is 6-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 16558063 |
| Molecular Formula | C30H36N2O7S2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 6-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CCCCCC(=O)O)C(=O)C45)C23)ccc1OCC(C)C |
| InChI | InChI=1S/C30H36N2O7S2/c1-14(2)13-39-18-9-8-15(11-19(18)38-3)21-22-16-12-17(25(22)40-27-26(21)41-30(37)31-27)24-23(16)28(35)32(29(24)36)10-6-4-5-7-20(33)34/h8-9,11,14,16-17,21-25H,4-7,10,12-13H2,1-3H3,(H,31,37)(H,33,34) |
| InChIKey | PVLBVDSSVFAWRB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|