C28H32N2O6S3 — CID 18865673
4-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 18865673) has the molecular formula C28H32N2O6S3 and a molecular weight of 588.77 g/mol. Its IUPAC name is 4-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 4-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 18865673 |
| Molecular Formula | C28H32N2O6S3 |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | 4-[9-[3-methoxy-4-(2-methylpropoxy)phenyl]-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | COc1cc(C2c3sc(=S)[nH]c3SC3C4CC(C5C(=O)N(CCCC(=O)O)C(=O)C45)C23)ccc1OCC(C)C |
| InChI | InChI=1S/C28H32N2O6S3/c1-12(2)11-36-16-7-6-13(9-17(16)35-3)19-20-14-10-15(23(20)38-25-24(19)39-28(37)29-25)22-21(14)26(33)30(27(22)34)8-4-5-18(31)32/h6-7,9,12,14-15,19-23H,4-5,8,10-11H2,1-3H3,(H,29,37)(H,31,32) |
| InChIKey | XHBUHEKZMDFCPM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|