C25H25BrN2O4S3 — CID 18865694
6-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 18865694) has the molecular formula C25H25BrN2O4S3 and a molecular weight of 593.59 g/mol. Its IUPAC name is 6-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 18865694 |
| Molecular Formula | C25H25BrN2O4S3 |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | 6-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(Br)c2)c2sc(=S)[nH]c2SC31 |
| InChI | InChI=1S/C25H25BrN2O4S3/c26-12-6-4-5-11(9-12)16-17-13-10-14(20(17)34-22-21(16)35-25(33)27-22)19-18(13)23(31)28(24(19)32)8-3-1-2-7-15(29)30/h4-6,9,13-14,16-20H,1-3,7-8,10H2,(H,27,33)(H,29,30) |
| InChIKey | QVMIKKZCGNPCBC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|