C27H31N3O5S2 — CID 98176415
6-[(1R,2S,9R,10R,11R,12R,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 98176415) has the molecular formula C27H31N3O5S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 6-[(1R,2S,9R,10R,11R,12R,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(1R,2S,9R,10R,11R,12R,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 98176415 |
| Molecular Formula | C27H31N3O5S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 6-[(1R,2S,9R,10R,11R,12R,16S)-9-[4-(dimethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | CN(C)c1ccc([C@@H]2c3sc(=O)[nH]c3S[C@H]3[C@@H]4C[C@H]([C@H]5C(=O)N(CCCCCC(=O)O)C(=O)[C@H]45)[C@H]23)cc1 |
| InChI | InChI=1S/C27H31N3O5S2/c1-29(2)14-9-7-13(8-10-14)18-19-15-12-16(22(19)36-24-23(18)37-27(35)28-24)21-20(15)25(33)30(26(21)34)11-5-3-4-6-17(31)32/h7-10,15-16,18-22H,3-6,11-12H2,1-2H3,(H,28,35)(H,31,32)/t15-,16+,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | IKXRJUVYEZFYKB-ZNYUTQCVSA-N |
| XLogP | 3.62 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|