C28H23BrN2O4S3 — CID 18865885
ethyl 4-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 18865885) has the molecular formula C28H23BrN2O4S3 and a molecular weight of 627.61 g/mol. Its IUPAC name is ethyl 4-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 18865885 |
| Molecular Formula | C28H23BrN2O4S3 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 626.00 |
| IUPAC Name | ethyl 4-[9-(3-bromophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cccc(Br)c3)c3sc(=S)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C28H23BrN2O4S3/c1-2-35-27(34)12-6-8-15(9-7-12)31-25(32)20-16-11-17(21(20)26(31)33)22-19(16)18(13-4-3-5-14(29)10-13)23-24(37-22)30-28(36)38-23/h3-10,16-22H,2,11H2,1H3,(H,30,36) |
| InChIKey | BXGRBHFGIJPIEQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|