C27H24N2O4S3 — CID 18865793
9-(3-hydroxy-4-methoxyphenyl)-14-(4-methylphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione (PubChem CID 18865793) has the molecular formula C27H24N2O4S3 and a molecular weight of 536.70 g/mol. Its IUPAC name is 9-(3-hydroxy-4-methoxyphenyl)-14-(4-methylphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione.
| Compound Name | 9-(3-hydroxy-4-methoxyphenyl)-14-(4-methylphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
|---|---|
| PubChem CID | 18865793 |
| Molecular Formula | C27H24N2O4S3 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 9-(3-hydroxy-4-methoxyphenyl)-14-(4-methylphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
| SMILES | COc1ccc(C2c3sc(=S)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(C)cc6)C(=O)C45)C23)cc1O |
| InChI | InChI=1S/C27H24N2O4S3/c1-11-3-6-13(7-4-11)29-25(31)20-14-10-15(21(20)26(29)32)22-19(14)18(23-24(35-22)28-27(34)36-23)12-5-8-17(33-2)16(30)9-12/h3-9,14-15,18-22,30H,10H2,1-2H3,(H,28,34) |
| InChIKey | LRWLSZQLESREKD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|