C27H24N2O5S3 — CID 18865759
9-(4-hydroxy-3,5-dimethoxyphenyl)-14-phenyl-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione (PubChem CID 18865759) has the molecular formula C27H24N2O5S3 and a molecular weight of 552.70 g/mol. Its IUPAC name is 9-(4-hydroxy-3,5-dimethoxyphenyl)-14-phenyl-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione.
| Compound Name | 9-(4-hydroxy-3,5-dimethoxyphenyl)-14-phenyl-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
|---|---|
| PubChem CID | 18865759 |
| Molecular Formula | C27H24N2O5S3 |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | 9-(4-hydroxy-3,5-dimethoxyphenyl)-14-phenyl-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
| SMILES | COc1cc(C2c3sc(=S)[nH]c3SC3C4CC(C5C(=O)N(c6ccccc6)C(=O)C45)C23)cc(OC)c1O |
| InChI | InChI=1S/C27H24N2O5S3/c1-33-15-8-11(9-16(34-2)21(15)30)17-18-13-10-14(22(18)36-24-23(17)37-27(35)28-24)20-19(13)25(31)29(26(20)32)12-6-4-3-5-7-12/h3-9,13-14,17-20,22,30H,10H2,1-2H3,(H,28,35) |
| InChIKey | ZNZDZOCGDDCGIE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|