C27H23FN2O6S2 — CID 16558000
14-(4-fluorophenyl)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 16558000) has the molecular formula C27H23FN2O6S2 and a molecular weight of 554.62 g/mol. Its IUPAC name is 14-(4-fluorophenyl)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | 14-(4-fluorophenyl)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 16558000 |
| Molecular Formula | C27H23FN2O6S2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | 14-(4-fluorophenyl)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(F)cc6)C(=O)C45)C23)cc(OC)c1O |
| InChI | InChI=1S/C27H23FN2O6S2/c1-35-15-7-10(8-16(36-2)21(15)31)17-18-13-9-14(22(18)37-24-23(17)38-27(34)29-24)20-19(13)25(32)30(26(20)33)12-5-3-11(28)4-6-12/h3-8,13-14,17-20,22,31H,9H2,1-2H3,(H,29,34) |
| InChIKey | CASPFJMMNJLJRP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|