C22H18N2O4S3 — CID 98423492
(1R,8R,9S)-8-(3-hydroxy-4-methoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione (PubChem CID 98423492) has the molecular formula C22H18N2O4S3 and a molecular weight of 470.60 g/mol. Its IUPAC name is (1R,8R,9S)-8-(3-hydroxy-4-methoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione.
| Compound Name | (1R,8R,9S)-8-(3-hydroxy-4-methoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 98423492 |
| Molecular Formula | C22H18N2O4S3 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | (1R,8R,9S)-8-(3-hydroxy-4-methoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
| SMILES | COc1ccc([C@@H]2c3sc(=S)[nH]c3S[C@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@H]23)cc1O |
| InChI | InChI=1S/C22H18N2O4S3/c1-10-3-6-12(7-4-10)24-20(26)16-15(11-5-8-14(28-2)13(25)9-11)17-19(23-22(29)31-17)30-18(16)21(24)27/h3-9,15-16,18,25H,1-2H3,(H,23,29)/t15-,16+,18+/m0/s1 |
| InChIKey | QEEHGGRIFOAGIG-LZLYRXPVSA-N |
| XLogP | 4.62 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|