C24H20N2O7S2 — CID 19251394
ethyl 4-[(1R,8R,9R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19251394) has the molecular formula C24H20N2O7S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19251394 |
| Molecular Formula | C24H20N2O7S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccc(O)c(OC)c4)c4sc(=O)[nH]c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H20N2O7S2/c1-3-33-23(30)11-4-7-13(8-5-11)26-21(28)17-16(12-6-9-14(27)15(10-12)32-2)18-20(25-24(31)35-18)34-19(17)22(26)29/h4-10,16-17,19,27H,3H2,1-2H3,(H,25,31)/t16-,17-,19+/m0/s1 |
| InChIKey | JPFBZYGYYDYEIT-JENIJYKNSA-N |
| XLogP | 3.12 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|