C31H24Cl2N2O7S2 — CID 78578873
ethyl 4-[(8S)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 78578873) has the molecular formula C31H24Cl2N2O7S2 and a molecular weight of 671.58 g/mol. Its IUPAC name is ethyl 4-[(8S)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 78578873 |
| Molecular Formula | C31H24Cl2N2O7S2 |
| Molecular Weight | 671.58 g/mol |
| Exact Mass | 670.04 |
| IUPAC Name | ethyl 4-[(8S)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4[C@H](c4ccc(OCc5ccc(Cl)cc5Cl)c(OC)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C31H24Cl2N2O7S2/c1-3-41-30(38)15-5-9-19(10-6-15)35-28(36)24-23(25-27(34-31(39)44-25)43-26(24)29(35)37)16-7-11-21(22(12-16)40-2)42-14-17-4-8-18(32)13-20(17)33/h4-13,23-24,26H,3,14H2,1-2H3,(H,34,39)/t23-,24?,26?/m1/s1 |
| InChIKey | NHWOTSGBAYAOJO-LPXOAACNSA-N |
| XLogP | 6.30 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|