C29H19Cl2F3N2O5S2 — CID 43850274
8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43850274) has the molecular formula C29H19Cl2F3N2O5S2 and a molecular weight of 667.51 g/mol. Its IUPAC name is 8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43850274 |
| Molecular Formula | C29H19Cl2F3N2O5S2 |
| Molecular Weight | 667.51 g/mol |
| Exact Mass | 666.01 |
| IUPAC Name | 8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H19Cl2F3N2O5S2/c1-40-20-10-13(7-9-19(20)41-12-14-6-8-15(30)11-17(14)31)21-22-24(42-25-23(21)43-28(39)35-25)27(38)36(26(22)37)18-5-3-2-4-16(18)29(32,33)34/h2-11,21-22,24H,12H2,1H3,(H,35,39) |
| InChIKey | BHCVXBQLOAECLP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.51 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|