C26H21F3N2O7S2 — CID 78579958
ethyl 2-[2-methoxy-4-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate (PubChem CID 78579958) has the molecular formula C26H21F3N2O7S2 and a molecular weight of 594.59 g/mol. Its IUPAC name is ethyl 2-[2-methoxy-4-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-methoxy-4-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 78579958 |
| Molecular Formula | C26H21F3N2O7S2 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.07 |
| IUPAC Name | ethyl 2-[2-methoxy-4-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)cc1OC |
| InChI | InChI=1S/C26H21F3N2O7S2/c1-3-37-17(32)11-38-15-9-8-12(10-16(15)36-2)18-19-21(39-22-20(18)40-25(35)30-22)24(34)31(23(19)33)14-7-5-4-6-13(14)26(27,28)29/h4-10,18-19,21H,3,11H2,1-2H3,(H,30,35)/t18-,19?,21?/m1/s1 |
| InChIKey | ITEPJDWKFWLVIR-LWEYNCJUSA-N |
| XLogP | 4.20 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|