C25H19F3N2O6S2 — CID 43852790
ethyl 2-[4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate (PubChem CID 43852790) has the molecular formula C25H19F3N2O6S2 and a molecular weight of 564.56 g/mol. Its IUPAC name is ethyl 2-[4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 43852790 |
| Molecular Formula | C25H19F3N2O6S2 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | ethyl 2-[4-[5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)cc1 |
| InChI | InChI=1S/C25H19F3N2O6S2/c1-2-35-16(31)11-36-13-9-7-12(8-10-13)17-18-20(37-21-19(17)38-24(34)29-21)23(33)30(22(18)32)15-6-4-3-5-14(15)25(26,27)28/h3-10,17-18,20H,2,11H2,1H3,(H,29,34) |
| InChIKey | JHQVEGFPFVGSRM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|