C23H18F3N3O3S2 — CID 78578628
(8S)-8-[4-(dimethylamino)phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 78578628) has the molecular formula C23H18F3N3O3S2 and a molecular weight of 505.54 g/mol. Its IUPAC name is (8S)-8-[4-(dimethylamino)phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-8-[4-(dimethylamino)phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 78578628 |
| Molecular Formula | C23H18F3N3O3S2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (8S)-8-[4-(dimethylamino)phenyl]-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CN(C)c1ccc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)cc1 |
| InChI | InChI=1S/C23H18F3N3O3S2/c1-28(2)12-9-7-11(8-10-12)15-16-18(33-19-17(15)34-22(32)27-19)21(31)29(20(16)30)14-6-4-3-5-13(14)23(24,25)26/h3-10,15-16,18H,1-2H3,(H,27,32)/t15-,16?,18?/m1/s1 |
| InChIKey | DEOBTRPTQQMRSA-KLHKWILBSA-N |
| XLogP | 4.32 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|