C24H19FN2O6S2 — CID 43852916
ethyl 2-[4-[11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate (PubChem CID 43852916) has the molecular formula C24H19FN2O6S2 and a molecular weight of 514.56 g/mol. Its IUPAC name is ethyl 2-[4-[11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 43852916 |
| Molecular Formula | C24H19FN2O6S2 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | ethyl 2-[4-[11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(F)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C24H19FN2O6S2/c1-2-32-16(28)11-33-15-9-3-12(4-10-15)17-18-20(34-21-19(17)35-24(31)26-21)23(30)27(22(18)29)14-7-5-13(25)6-8-14/h3-10,17-18,20H,2,11H2,1H3,(H,26,31) |
| InChIKey | ZXJJTWALQIHEDZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|