C25H22N2O7S2 — CID 19254702
ethyl 2-[4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate (PubChem CID 19254702) has the molecular formula C25H22N2O7S2 and a molecular weight of 526.59 g/mol. Its IUPAC name is ethyl 2-[4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 19254702 |
| Molecular Formula | C25H22N2O7S2 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | ethyl 2-[4-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccc(OC)cc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C25H22N2O7S2/c1-3-33-17(28)12-34-16-8-4-13(5-9-16)18-19-21(35-22-20(18)36-25(31)26-22)24(30)27(23(19)29)14-6-10-15(32-2)11-7-14/h4-11,18-19,21H,3,12H2,1-2H3,(H,26,31)/t18-,19-,21+/m0/s1 |
| InChIKey | HSZNSAAUSJGQQC-IRFCIJBXSA-N |
| XLogP | 3.18 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|