C28H20FN3O5S2 — CID 19255066
2-[4-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide (PubChem CID 19255066) has the molecular formula C28H20FN3O5S2 and a molecular weight of 561.62 g/mol. Its IUPAC name is 2-[4-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 19255066 |
| Molecular Formula | C28H20FN3O5S2 |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | 2-[4-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@@H]23)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C28H20FN3O5S2/c29-16-8-10-18(11-9-16)32-26(34)22-21(23-25(31-28(36)39-23)38-24(22)27(32)35)15-6-12-19(13-7-15)37-14-20(33)30-17-4-2-1-3-5-17/h1-13,21-22,24H,14H2,(H,30,33)(H,31,36)/t21-,22-,24+/m0/s1 |
| InChIKey | CSIGRBPWPJOMMS-WPFOTENUSA-N |
| XLogP | 4.39 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|