C30H25N3O5S2 — CID 43851780
N-(3-methylphenyl)-2-[4-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 43851780) has the molecular formula C30H25N3O5S2 and a molecular weight of 571.68 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[4-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[4-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 43851780 |
| Molecular Formula | C30H25N3O5S2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | N-(3-methylphenyl)-2-[4-[11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4C(c4ccc(OCC(=O)Nc5cccc(C)c5)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C30H25N3O5S2/c1-16-6-10-20(11-7-16)33-28(35)24-23(25-27(32-30(37)40-25)39-26(24)29(33)36)18-8-12-21(13-9-18)38-15-22(34)31-19-5-3-4-17(2)14-19/h3-14,23-24,26H,15H2,1-2H3,(H,31,34)(H,32,37) |
| InChIKey | WJZULEWNJDUKJJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|