C32H29N3O6S2 — CID 19253998
2-[2-ethoxy-4-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 19253998) has the molecular formula C32H29N3O6S2 and a molecular weight of 615.73 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19253998 |
| Molecular Formula | C32H29N3O6S2 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | 2-[2-ethoxy-4-[(1R,8R,9R)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1cc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@@H]23)ccc1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C32H29N3O6S2/c1-4-40-23-15-19(10-13-22(23)41-16-24(36)33-20-7-5-6-18(3)14-20)25-26-28(42-29-27(25)43-32(39)34-29)31(38)35(30(26)37)21-11-8-17(2)9-12-21/h5-15,25-26,28H,4,16H2,1-3H3,(H,33,36)(H,34,39)/t25-,26-,28+/m0/s1 |
| InChIKey | SOEVTHQDKCIKAX-UNCTUWKVSA-N |
| XLogP | 5.27 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|