C32H29N3O7S2 — CID 78579826
2-[2-ethoxy-4-[(8S)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 78579826) has the molecular formula C32H29N3O7S2 and a molecular weight of 631.73 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(8S)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(8S)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 78579826 |
| Molecular Formula | C32H29N3O7S2 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | 2-[2-ethoxy-4-[(8S)-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(OC)cc4)C(=O)C32)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C32H29N3O7S2/c1-4-41-23-15-18(7-14-22(23)42-16-24(36)33-19-8-5-17(2)6-9-19)25-26-28(43-29-27(25)44-32(39)34-29)31(38)35(30(26)37)20-10-12-21(40-3)13-11-20/h5-15,25-26,28H,4,16H2,1-3H3,(H,33,36)(H,34,39)/t25-,26?,28?/m1/s1 |
| InChIKey | XAHLVDHCWPCVRN-DIXXZCBKSA-N |
| XLogP | 4.97 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|