C34H31N3O8S2 — CID 19254366
ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19254366) has the molecular formula C34H31N3O8S2 and a molecular weight of 673.77 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19254366 |
| Molecular Formula | C34H31N3O8S2 |
| Molecular Weight | 673.77 g/mol |
| Exact Mass | 673.16 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccc(OCC(=O)Nc5ccc(C)cc5)c(OCC)c4)c4sc(=O)[nH]c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C34H31N3O8S2/c1-4-43-24-16-20(10-15-23(24)45-17-25(38)35-21-11-6-18(3)7-12-21)26-27-29(46-30-28(26)47-34(42)36-30)32(40)37(31(27)39)22-13-8-19(9-14-22)33(41)44-5-2/h6-16,26-27,29H,4-5,17H2,1-3H3,(H,35,38)(H,36,42)/t26-,27-,29+/m0/s1 |
| InChIKey | MSFGTLDUDBCZKW-HPUNYJORSA-N |
| XLogP | 5.13 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.77 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|