C29H27N3O10S2 — CID 19253865
2-[(1S,8R,9S)-8-[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 19253865) has the molecular formula C29H27N3O10S2 and a molecular weight of 641.68 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-8-[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(1S,8R,9S)-8-[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 19253865 |
| Molecular Formula | C29H27N3O10S2 |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 641.11 |
| IUPAC Name | 2-[(1S,8R,9S)-8-[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc([C@@H]3c4sc(=O)[nH]c4S[C@@H]4C(=O)N(CC(=O)O)C(=O)[C@H]34)cc2OCC)cc1 |
| InChI | InChI=1S/C29H27N3O10S2/c1-3-40-18-11-15(7-10-17(18)42-13-19(33)30-16-8-5-14(6-9-16)28(38)41-4-2)21-22-24(43-25-23(21)44-29(39)31-25)27(37)32(26(22)36)12-20(34)35/h5-11,21-22,24H,3-4,12-13H2,1-2H3,(H,30,33)(H,31,39)(H,34,35)/t21-,22+,24-/m0/s1 |
| InChIKey | OCAVRRGKRRDSRG-ZDXQCDESSA-N |
| XLogP | 2.71 |
| TPSA | 181.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|