C25H21N3O9S2 — CID 19253853
2-[(1S,8R,9S)-8-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 19253853) has the molecular formula C25H21N3O9S2 and a molecular weight of 571.59 g/mol. Its IUPAC name is 2-[(1S,8R,9S)-8-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(1S,8R,9S)-8-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 19253853 |
| Molecular Formula | C25H21N3O9S2 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | 2-[(1S,8R,9S)-8-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | COc1cc([C@@H]2c3sc(=O)[nH]c3S[C@@H]3C(=O)N(CC(=O)O)C(=O)[C@H]23)ccc1OCC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C25H21N3O9S2/c1-36-15-8-11(2-7-14(15)37-10-16(30)26-12-3-5-13(29)6-4-12)18-19-21(38-22-20(18)39-25(35)27-22)24(34)28(23(19)33)9-17(31)32/h2-8,18-19,21,29H,9-10H2,1H3,(H,26,30)(H,27,35)(H,31,32)/t18-,19+,21-/m0/s1 |
| InChIKey | ULOOJSLMQNCLLU-ZVDOUQERSA-N |
| XLogP | 1.84 |
| TPSA | 175.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|