C25H20BrN3O8S2 — CID 78581450
2-[(8S)-8-[5-bromo-2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 78581450) has the molecular formula C25H20BrN3O8S2 and a molecular weight of 634.49 g/mol. Its IUPAC name is 2-[(8S)-8-[5-bromo-2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8S)-8-[5-bromo-2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 78581450 |
| Molecular Formula | C25H20BrN3O8S2 |
| Molecular Weight | 634.49 g/mol |
| Exact Mass | 632.99 |
| IUPAC Name | 2-[(8S)-8-[5-bromo-2-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | COc1ccc(NC(=O)COc2ccc(Br)cc2[C@H]2c3sc(=O)[nH]c3SC3C(=O)N(CC(=O)O)C(=O)C32)cc1 |
| InChI | InChI=1S/C25H20BrN3O8S2/c1-36-13-5-3-12(4-6-13)27-16(30)10-37-15-7-2-11(26)8-14(15)18-19-21(38-22-20(18)39-25(35)28-22)24(34)29(23(19)33)9-17(31)32/h2-8,18-19,21H,9-10H2,1H3,(H,27,30)(H,28,35)(H,31,32)/t18-,19?,21?/m1/s1 |
| InChIKey | UFVRPADZYJTHGB-LWEYNCJUSA-N |
| XLogP | 2.90 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|