C27H22BrN3O9S2 — CID 43851755
2-[(8R)-8-[5-bromo-2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 43851755) has the molecular formula C27H22BrN3O9S2 and a molecular weight of 676.52 g/mol. Its IUPAC name is 2-[(8R)-8-[5-bromo-2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8R)-8-[5-bromo-2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 43851755 |
| Molecular Formula | C27H22BrN3O9S2 |
| Molecular Weight | 676.52 g/mol |
| Exact Mass | 675.00 |
| IUPAC Name | 2-[(8R)-8-[5-bromo-2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(Br)cc2[C@@H]2c3sc(=O)[nH]c3SC3C(=O)N(CC(=O)O)C(=O)C32)cc1 |
| InChI | InChI=1S/C27H22BrN3O9S2/c1-2-39-26(37)12-3-6-14(7-4-12)29-17(32)11-40-16-8-5-13(28)9-15(16)19-20-22(41-23-21(19)42-27(38)30-23)25(36)31(24(20)35)10-18(33)34/h3-9,19-20,22H,2,10-11H2,1H3,(H,29,32)(H,30,38)(H,33,34)/t19-,20?,22?/m0/s1 |
| InChIKey | HRIKAHVYAPYLLR-YMISUZCDSA-N |
| XLogP | 3.07 |
| TPSA | 172.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|