C25H20ClN3O7S2 — CID 43851744
2-[(8R)-8-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 43851744) has the molecular formula C25H20ClN3O7S2 and a molecular weight of 574.04 g/mol. Its IUPAC name is 2-[(8R)-8-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8R)-8-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 43851744 |
| Molecular Formula | C25H20ClN3O7S2 |
| Molecular Weight | 574.04 g/mol |
| Exact Mass | 573.04 |
| IUPAC Name | 2-[(8R)-8-[5-chloro-2-[2-(3-methylanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Cl)cc2[C@@H]2c3sc(=O)[nH]c3SC3C(=O)N(CC(=O)O)C(=O)C32)c1 |
| InChI | InChI=1S/C25H20ClN3O7S2/c1-11-3-2-4-13(7-11)27-16(30)10-36-15-6-5-12(26)8-14(15)18-19-21(37-22-20(18)38-25(35)28-22)24(34)29(23(19)33)9-17(31)32/h2-8,18-19,21H,9-10H2,1H3,(H,27,30)(H,28,35)(H,31,32)/t18-,19?,21?/m0/s1 |
| InChIKey | NRXVWNCJTXKTTF-JSOIOWGOSA-N |
| XLogP | 3.09 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.04 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|