C24H18ClN3O7S2 — CID 43851715
2-[(8R)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 43851715) has the molecular formula C24H18ClN3O7S2 and a molecular weight of 560.01 g/mol. Its IUPAC name is 2-[(8R)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8R)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 43851715 |
| Molecular Formula | C24H18ClN3O7S2 |
| Molecular Weight | 560.01 g/mol |
| Exact Mass | 559.03 |
| IUPAC Name | 2-[(8R)-8-[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2Sc3[nH]c(=O)sc3[C@@H](c3ccccc3OCC(=O)Nc3ccc(Cl)cc3)C2C1=O |
| InChI | InChI=1S/C24H18ClN3O7S2/c25-11-5-7-12(8-6-11)26-15(29)10-35-14-4-2-1-3-13(14)17-18-20(36-21-19(17)37-24(34)27-21)23(33)28(22(18)32)9-16(30)31/h1-8,17-18,20H,9-10H2,(H,26,29)(H,27,34)(H,30,31)/t17-,18?,20?/m0/s1 |
| InChIKey | SJKOXVFHHMWULU-ZJRDLVKKSA-N |
| XLogP | 2.78 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.01 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|