C24H16Cl3N3O7S2 — CID 43851749
2-[(8R)-8-[5-chloro-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid (PubChem CID 43851749) has the molecular formula C24H16Cl3N3O7S2 and a molecular weight of 628.90 g/mol. Its IUPAC name is 2-[(8R)-8-[5-chloro-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid.
| Compound Name | 2-[(8R)-8-[5-chloro-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
|---|---|
| PubChem CID | 43851749 |
| Molecular Formula | C24H16Cl3N3O7S2 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 626.95 |
| IUPAC Name | 2-[(8R)-8-[5-chloro-2-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2Sc3[nH]c(=O)sc3[C@@H](c3cc(Cl)ccc3OCC(=O)Nc3ccc(Cl)c(Cl)c3)C2C1=O |
| InChI | InChI=1S/C24H16Cl3N3O7S2/c25-9-1-4-14(37-8-15(31)28-10-2-3-12(26)13(27)6-10)11(5-9)17-18-20(38-21-19(17)39-24(36)29-21)23(35)30(22(18)34)7-16(32)33/h1-6,17-18,20H,7-8H2,(H,28,31)(H,29,36)(H,32,33)/t17-,18?,20?/m0/s1 |
| InChIKey | PSJZINNKNJQJJV-ZJRDLVKKSA-N |
| XLogP | 4.09 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|