C28H18BrCl2N3O5S2 — CID 78579573
2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 78579573) has the molecular formula C28H18BrCl2N3O5S2 and a molecular weight of 691.41 g/mol. Its IUPAC name is 2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 78579573 |
| Molecular Formula | C28H18BrCl2N3O5S2 |
| Molecular Weight | 691.41 g/mol |
| Exact Mass | 688.92 |
| IUPAC Name | 2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1[C@H]1c2sc(=O)[nH]c2SC2C(=O)N(c3ccccc3)C(=O)C21)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H18BrCl2N3O5S2/c29-13-6-9-19(39-12-20(35)32-14-7-8-17(30)18(31)11-14)16(10-13)21-22-24(40-25-23(21)41-28(38)33-25)27(37)34(26(22)36)15-4-2-1-3-5-15/h1-11,21-22,24H,12H2,(H,32,35)(H,33,38)/t21-,22?,24?/m1/s1 |
| InChIKey | KLHCFFQBDXCCPV-ZLHNRXBCSA-N |
| XLogP | 6.32 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|