C29H19BrF3N3O5S2 — CID 78580045
2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide (PubChem CID 78580045) has the molecular formula C29H19BrF3N3O5S2 and a molecular weight of 690.52 g/mol. Its IUPAC name is 2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 78580045 |
| Molecular Formula | C29H19BrF3N3O5S2 |
| Molecular Weight | 690.52 g/mol |
| Exact Mass | 688.99 |
| IUPAC Name | 2-[4-bromo-2-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(Br)cc1[C@H]1c2sc(=O)[nH]c2SC2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)C21)Nc1ccccc1 |
| InChI | InChI=1S/C29H19BrF3N3O5S2/c30-15-9-10-19(41-13-20(37)34-16-6-2-1-3-7-16)18(12-15)21-22-24(42-25-23(21)43-28(40)35-25)27(39)36(26(22)38)17-8-4-5-14(11-17)29(31,32)33/h1-12,21-22,24H,13H2,(H,34,37)(H,35,40)/t21-,22?,24?/m1/s1 |
| InChIKey | UUNJZYOKFQVTAO-ZLHNRXBCSA-N |
| XLogP | 6.03 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|