C30H21BrF3N3O6S2 — CID 19254679
2-[4-bromo-2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 19254679) has the molecular formula C30H21BrF3N3O6S2 and a molecular weight of 720.54 g/mol. Its IUPAC name is 2-[4-bromo-2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19254679 |
| Molecular Formula | C30H21BrF3N3O6S2 |
| Molecular Weight | 720.54 g/mol |
| Exact Mass | 719.00 |
| IUPAC Name | 2-[4-bromo-2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(Br)cc2[C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C30H21BrF3N3O6S2/c1-42-18-8-6-16(7-9-18)35-21(38)13-43-20-10-5-15(31)12-19(20)22-23-25(44-26-24(22)45-29(41)36-26)28(40)37(27(23)39)17-4-2-3-14(11-17)30(32,33)34/h2-12,22-23,25H,13H2,1H3,(H,35,38)(H,36,41)/t22-,23-,25+/m0/s1 |
| InChIKey | HXGQZQACBFEFAT-SONWIMMPSA-N |
| XLogP | 6.04 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|