C31H24F3N3O7S2 — CID 43852443
N-(4-methoxyphenyl)-2-[2-methoxy-4-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 43852443) has the molecular formula C31H24F3N3O7S2 and a molecular weight of 671.68 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[2-methoxy-4-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[2-methoxy-4-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 43852443 |
| Molecular Formula | C31H24F3N3O7S2 |
| Molecular Weight | 671.68 g/mol |
| Exact Mass | 671.10 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[2-methoxy-4-[5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(C3c4sc(=O)[nH]c4SC4C(=O)N(c5cccc(C(F)(F)F)c5)C(=O)C43)cc2OC)cc1 |
| InChI | InChI=1S/C31H24F3N3O7S2/c1-42-19-9-7-17(8-10-19)35-22(38)14-44-20-11-6-15(12-21(20)43-2)23-24-26(45-27-25(23)46-30(41)36-27)29(40)37(28(24)39)18-5-3-4-16(13-18)31(32,33)34/h3-13,23-24,26H,14H2,1-2H3,(H,35,38)(H,36,41) |
| InChIKey | NVRHQLKPPUJZQQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|