C29H20F3N3O6S2 — CID 78580019
N-(4-hydroxyphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 78580019) has the molecular formula C29H20F3N3O6S2 and a molecular weight of 627.62 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78580019 |
| Molecular Formula | C29H20F3N3O6S2 |
| Molecular Weight | 627.62 g/mol |
| Exact Mass | 627.07 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[4-[(8S)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)cc1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C29H20F3N3O6S2/c30-29(31,32)15-2-1-3-17(12-15)35-26(38)22-21(23-25(34-28(40)43-23)42-24(22)27(35)39)14-4-10-19(11-5-14)41-13-20(37)33-16-6-8-18(36)9-7-16/h1-12,21-22,24,36H,13H2,(H,33,37)(H,34,40)/t21-,22?,24?/m1/s1 |
| InChIKey | DAELBXJWOGXWIL-ZLHNRXBCSA-N |
| XLogP | 4.97 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|